C14H18BNO2 — CID 11021090
4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzonitrile (PubChem CID 11021090) has the molecular formula C14H18BNO2 and a molecular weight of 243.11 g/mol. Its IUPAC name is 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzonitrile.
| Compound Name | 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 11021090 |
| Molecular Formula | C14H18BNO2 |
| Molecular Weight | 243.11 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzonitrile |
| SMILES | CC1(C)OB(Cc2ccc(C#N)cc2)OC1(C)C |
| InChI | InChI=1S/C14H18BNO2/c1-13(2)14(3,4)18-15(17-13)9-11-5-7-12(10-16)8-6-11/h5-8H,9H2,1-4H3 |
| InChIKey | IBNNFFDCOHDYJE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.11 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|