C25H24N2O5 — CID 110210941
(1S,9R,11R)-6-(furan-2-yl)-3-methyl-N-(4-methylphenyl)-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxamide (PubChem CID 110210941) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is (1S,9R,11R)-6-(furan-2-yl)-3-methyl-N-(4-methylphenyl)-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxamide.
| Compound Name | (1S,9R,11R)-6-(furan-2-yl)-3-methyl-N-(4-methylphenyl)-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxamide |
|---|---|
| PubChem CID | 110210941 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | (1S,9R,11R)-6-(furan-2-yl)-3-methyl-N-(4-methylphenyl)-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2[C@H]3C(=O)N4C(c5ccco5)CC(=O)C(C)C4[C@]34C=C[C@H]2O4)cc1 |
| InChI | InChI=1S/C25H24N2O5/c1-13-5-7-15(8-6-13)26-23(29)20-19-9-10-25(32-19)21(20)24(30)27-16(18-4-3-11-31-18)12-17(28)14(2)22(25)27/h3-11,14,16,19-22H,12H2,1-2H3,(H,26,29)/t14?,16?,19-,20?,21+,22?,25+/m1/s1 |
| InChIKey | IBWVDLQGQPPIOV-CIMKDJCISA-N |
| XLogP | 3.03 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|