C25H22N2O7 — CID 98139594
(1S,2S,3S,6S,9R,10S,11S)-N-(1,3-benzodioxol-5-yl)-6-(furan-2-yl)-3-methyl-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxamide (PubChem CID 98139594) has the molecular formula C25H22N2O7 and a molecular weight of 462.46 g/mol. Its IUPAC name is (1S,2S,3S,6S,9R,10S,11S)-N-(1,3-benzodioxol-5-yl)-6-(furan-2-yl)-3-methyl-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxamide.
| Compound Name | (1S,2S,3S,6S,9R,10S,11S)-N-(1,3-benzodioxol-5-yl)-6-(furan-2-yl)-3-methyl-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxamide |
|---|---|
| PubChem CID | 98139594 |
| Molecular Formula | C25H22N2O7 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | (1S,2S,3S,6S,9R,10S,11S)-N-(1,3-benzodioxol-5-yl)-6-(furan-2-yl)-3-methyl-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxamide |
| SMILES | C[C@@H]1C(=O)C[C@@H](c2ccco2)N2C(=O)[C@@H]3[C@H](C(=O)Nc4ccc5c(c4)OCO5)[C@@H]4C=C[C@@]3(O4)[C@H]12 |
| InChI | InChI=1S/C25H22N2O7/c1-12-15(28)10-14(16-3-2-8-31-16)27-22(12)25-7-6-18(34-25)20(21(25)24(27)30)23(29)26-13-4-5-17-19(9-13)33-11-32-17/h2-9,12,14,18,20-22H,10-11H2,1H3,(H,26,29)/t12-,14+,18+,20-,21+,22+,25+/m1/s1 |
| InChIKey | LSRIMIMKYMVJJN-IJCNETTBSA-N |
| XLogP | 2.45 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|