C21H17N3O3S — CID 110211084
(13Z)-13-benzylidene-9-methyl-14-oxo-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraene-16-carboxamide (PubChem CID 110211084) has the molecular formula C21H17N3O3S and a molecular weight of 391.45 g/mol. Its IUPAC name is (13Z)-13-benzylidene-9-methyl-14-oxo-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraene-16-carboxamide.
| Compound Name | (13Z)-13-benzylidene-9-methyl-14-oxo-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraene-16-carboxamide |
|---|---|
| PubChem CID | 110211084 |
| Molecular Formula | C21H17N3O3S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | (13Z)-13-benzylidene-9-methyl-14-oxo-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraene-16-carboxamide |
| SMILES | CC12N=c3s/c(=C\c4ccccc4)c(=O)n3C(c3ccccc3O1)C2C(N)=O |
| InChI | InChI=1S/C21H17N3O3S/c1-21-16(18(22)25)17(13-9-5-6-10-14(13)27-21)24-19(26)15(28-20(24)23-21)11-12-7-3-2-4-8-12/h2-11,16-17H,1H3,(H2,22,25)/b15-11- |
| InChIKey | FYAXMJNYQRJAFG-PTNGSMBKSA-N |
| XLogP | 1.17 |
| TPSA | 86.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |