C29H26N4O3S — CID 98153632
(1S,9R,13Z,16S)-13-[[4-(dimethylamino)phenyl]methylidene]-9-methyl-14-oxo-N-phenyl-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraene-16-carboxamide (PubChem CID 98153632) has the molecular formula C29H26N4O3S and a molecular weight of 510.62 g/mol. Its IUPAC name is (1S,9R,13Z,16S)-13-[[4-(dimethylamino)phenyl]methylidene]-9-methyl-14-oxo-N-phenyl-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraene-16-carboxamide.
| Compound Name | (1S,9R,13Z,16S)-13-[[4-(dimethylamino)phenyl]methylidene]-9-methyl-14-oxo-N-phenyl-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraene-16-carboxamide |
|---|---|
| PubChem CID | 98153632 |
| Molecular Formula | C29H26N4O3S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | (1S,9R,13Z,16S)-13-[[4-(dimethylamino)phenyl]methylidene]-9-methyl-14-oxo-N-phenyl-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraene-16-carboxamide |
| SMILES | CN(C)c1ccc(/C=c2\sc3n(c2=O)[C@@H]2c4ccccc4O[C@@](C)(N=3)[C@H]2C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C29H26N4O3S/c1-29-24(26(34)30-19-9-5-4-6-10-19)25(21-11-7-8-12-22(21)36-29)33-27(35)23(37-28(33)31-29)17-18-13-15-20(16-14-18)32(2)3/h4-17,24-25H,1-3H3,(H,30,34)/b23-17-/t24-,25-,29-/m1/s1 |
| InChIKey | LYUDETRYFXGFLM-ZWVCESGASA-N |
| XLogP | 3.39 |
| TPSA | 75.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|