C27H20N4O5S — CID 19590378
(13E)-9-methyl-13-[(4-nitrophenyl)methylidene]-14-oxo-N-phenyl-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraene-16-carboxamide (PubChem CID 19590378) has the molecular formula C27H20N4O5S and a molecular weight of 512.55 g/mol. Its IUPAC name is (13E)-9-methyl-13-[(4-nitrophenyl)methylidene]-14-oxo-N-phenyl-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraene-16-carboxamide.
| Compound Name | (13E)-9-methyl-13-[(4-nitrophenyl)methylidene]-14-oxo-N-phenyl-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraene-16-carboxamide |
|---|---|
| PubChem CID | 19590378 |
| Molecular Formula | C27H20N4O5S |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | (13E)-9-methyl-13-[(4-nitrophenyl)methylidene]-14-oxo-N-phenyl-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraene-16-carboxamide |
| SMILES | CC12N=c3s/c(=C/c4ccc([N+](=O)[O-])cc4)c(=O)n3C(c3ccccc3O1)C2C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C27H20N4O5S/c1-27-22(24(32)28-17-7-3-2-4-8-17)23(19-9-5-6-10-20(19)36-27)30-25(33)21(37-26(30)29-27)15-16-11-13-18(14-12-16)31(34)35/h2-15,22-23H,1H3,(H,28,32)/b21-15+ |
| InChIKey | KOYHPKWQYPBZJT-RCCKNPSSSA-N |
| XLogP | 3.23 |
| TPSA | 115.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|