C17H23ClN2O3 — CID 110211476
2-[(3S)-2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-3-yl]ethanol (PubChem CID 110211476) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is 2-[(3S)-2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-3-yl]ethanol.
| Compound Name | 2-[(3S)-2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-3-yl]ethanol |
|---|---|
| PubChem CID | 110211476 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-[(3S)-2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-3-yl]ethanol |
| SMILES | OCC[C@H]1CN2CCCC2CN1Cc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C17H23ClN2O3/c18-15-7-17-16(22-11-23-17)6-12(15)8-20-10-13-2-1-4-19(13)9-14(20)3-5-21/h6-7,13-14,21H,1-5,8-11H2/t13?,14-/m0/s1 |
| InChIKey | GDHZTLHBKZXAGP-KZUDCZAMSA-N |
| XLogP | 2.10 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |