C15H21NO4S — CID 110211607
(3S)-3-[(3-methoxyphenoxy)methyl]-2-methylsulfonyl-2-azabicyclo[2.2.1]heptane (PubChem CID 110211607) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is (3S)-3-[(3-methoxyphenoxy)methyl]-2-methylsulfonyl-2-azabicyclo[2.2.1]heptane.
| Compound Name | (3S)-3-[(3-methoxyphenoxy)methyl]-2-methylsulfonyl-2-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 110211607 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (3S)-3-[(3-methoxyphenoxy)methyl]-2-methylsulfonyl-2-azabicyclo[2.2.1]heptane |
| SMILES | COc1cccc(OC[C@@H]2C3CCC(C3)N2S(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H21NO4S/c1-19-13-4-3-5-14(9-13)20-10-15-11-6-7-12(8-11)16(15)21(2,17)18/h3-5,9,11-12,15H,6-8,10H2,1-2H3/t11?,12?,15-/m1/s1 |
| InChIKey | SBAAUBGVNGZMFD-KOHJWAIASA-N |
| XLogP | 1.89 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |