C17H23NO4 — CID 110211601
2-methoxy-1-[(3S)-3-[(3-methoxyphenoxy)methyl]-2-azabicyclo[2.2.1]heptan-2-yl]ethanone (PubChem CID 110211601) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 2-methoxy-1-[(3S)-3-[(3-methoxyphenoxy)methyl]-2-azabicyclo[2.2.1]heptan-2-yl]ethanone.
| Compound Name | 2-methoxy-1-[(3S)-3-[(3-methoxyphenoxy)methyl]-2-azabicyclo[2.2.1]heptan-2-yl]ethanone |
|---|---|
| PubChem CID | 110211601 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-methoxy-1-[(3S)-3-[(3-methoxyphenoxy)methyl]-2-azabicyclo[2.2.1]heptan-2-yl]ethanone |
| SMILES | COCC(=O)N1C2CCC(C2)[C@H]1COc1cccc(OC)c1 |
| InChI | InChI=1S/C17H23NO4/c1-20-11-17(19)18-13-7-6-12(8-13)16(18)10-22-15-5-3-4-14(9-15)21-2/h3-5,9,12-13,16H,6-8,10-11H2,1-2H3/t12?,13?,16-/m1/s1 |
| InChIKey | ZGDFUIXCMNHQDU-SEEARECTSA-N |
| XLogP | 2.10 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |