C22H25NO5S — CID 90591334
1-[3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]-2-(3-methoxyphenoxy)ethanone (PubChem CID 90591334) has the molecular formula C22H25NO5S and a molecular weight of 415.51 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]-2-(3-methoxyphenoxy)ethanone.
| Compound Name | 1-[3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]-2-(3-methoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 90591334 |
| Molecular Formula | C22H25NO5S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 1-[3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]-2-(3-methoxyphenoxy)ethanone |
| SMILES | COc1cccc(OCC(=O)N2C3CCC2CC(S(=O)(=O)c2ccccc2)C3)c1 |
| InChI | InChI=1S/C22H25NO5S/c1-27-18-6-5-7-19(14-18)28-15-22(24)23-16-10-11-17(23)13-21(12-16)29(25,26)20-8-3-2-4-9-20/h2-9,14,16-17,21H,10-13,15H2,1H3 |
| InChIKey | STUXBGUHCVOJAU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |