C20H21ClN4O3S — CID 110211878
CID 110211878 (PubChem CID 110211878) has the molecular formula C20H21ClN4O3S and a molecular weight of 432.93 g/mol.
| Compound Name | CID 110211878 |
|---|---|
| PubChem CID | 110211878 |
| Molecular Formula | C20H21ClN4O3S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | — |
| SMILES | Cc1ncsc1C(=O)N1CCC2(CC1)CC1(CO2)NC(=O)c2cc(Cl)ccc2N1 |
| InChI | InChI=1S/C20H21ClN4O3S/c1-12-16(29-11-22-12)18(27)25-6-4-19(5-7-25)9-20(10-28-19)23-15-3-2-13(21)8-14(15)17(26)24-20/h2-3,8,11,23H,4-7,9-10H2,1H3,(H,24,26) |
| InChIKey | FKAAXFALTQUHPD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |