N-(trichloro-λ5-phosphanylidene)sulfamoyl chloride

Cl4NO2PS — CID 11021330

IUPACN-(trichloro-λ5-phosphanylidene)sulfamoyl chloride
SMILESO=S(=O)(Cl)N=P(Cl)(Cl)Cl
InChIInChI=1S/Cl4NO2PS/c1-8(2,3)5-9(4,6)7
InChIKeyYXLOSEFXUQTKTI-UHFFFAOYSA-N
MW250.86 g/mol
LogP3.13
Rot. Bonds1

About N-(trichloro-λ5-phosphanylidene)sulfamoyl chloride

N-(trichloro-λ5-phosphanylidene)sulfamoyl chloride (PubChem CID 11021330) has the molecular formula Cl4NO2PS and a molecular weight of 250.86 g/mol. Its IUPAC name is N-(trichloro-λ5-phosphanylidene)sulfamoyl chloride.

Molecular Properties

Compound NameN-(trichloro-λ5-phosphanylidene)sulfamoyl chloride
PubChem CID11021330
Molecular FormulaCl4NO2PS
Molecular Weight250.86 g/mol
Exact Mass248.81
IUPAC NameN-(trichloro-λ5-phosphanylidene)sulfamoyl chloride
SMILESO=S(=O)(Cl)N=P(Cl)(Cl)Cl
InChIInChI=1S/Cl4NO2PS/c1-8(2,3)5-9(4,6)7
InChIKeyYXLOSEFXUQTKTI-UHFFFAOYSA-N
XLogP3.13
TPSA46.50 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.86
LogP ≤ 53.13
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze N-(trichloro-λ5-phosphanylidene)sulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

N-oxosulfamoyl chloride
CID 20702495
N-methylidenesulfamoyl chloride
CID 58939083
CID 59953690
CID 59953690
chlorosulfonylazanide;yttrium
CID 59654506
difluorophosphorylmethanesulfonyl chloride
CID 12549375
trichloro(dichlorophosphorylimino)-λ5-phosphane
CID 11777840
CID 15787726
CID 15787726
cobalt;sulfurochloridic acid
CID 174997282
cyclopentane;sulfuryl dichloride
CID 87352462
trichloro(methylimino)-lambda5-phosphane
CID 12670089
(1Z)-N-chlorosulfonyl-2,2,2-trifluoroethanimidoyl chloride
CID 55279207
N-(trifluoro-λ5-phosphanylidene)sulfamoyl fluoride
CID 23234948

Frequently Asked Questions

What is the IUPAC name of N-(trichloro-λ5-phosphanylidene)sulfamoyl chloride?
The IUPAC name of N-(trichloro-λ5-phosphanylidene)sulfamoyl chloride (CID 11021330) is N-(trichloro-λ5-phosphanylidene)sulfamoyl chloride.
What is the SMILES notation for N-(trichloro-λ5-phosphanylidene)sulfamoyl chloride?
The canonical SMILES for N-(trichloro-λ5-phosphanylidene)sulfamoyl chloride is O=S(=O)(Cl)N=P(Cl)(Cl)Cl.
What is the InChIKey of N-(trichloro-λ5-phosphanylidene)sulfamoyl chloride?
The InChIKey is YXLOSEFXUQTKTI-UHFFFAOYSA-N. The full InChI is InChI=1S/Cl4NO2PS/c1-8(2,3)5-9(4,6)7.
What are the key properties of N-(trichloro-λ5-phosphanylidene)sulfamoyl chloride?
N-(trichloro-λ5-phosphanylidene)sulfamoyl chloride has a molecular weight of 250.86 g/mol, XLogP of 3.13, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(trichloro-λ5-phosphanylidene)sulfamoyl chloride is sourced from PubChem (CID 11021330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).