C22H22ClF2N3O — CID 110215513
3-[(7-chloropyrrolo[2,3-c]pyridin-1-yl)methyl]-8-[(3,4-difluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 110215513) has the molecular formula C22H22ClF2N3O and a molecular weight of 417.89 g/mol. Its IUPAC name is 3-[(7-chloropyrrolo[2,3-c]pyridin-1-yl)methyl]-8-[(3,4-difluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-[(7-chloropyrrolo[2,3-c]pyridin-1-yl)methyl]-8-[(3,4-difluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 110215513 |
| Molecular Formula | C22H22ClF2N3O |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 3-[(7-chloropyrrolo[2,3-c]pyridin-1-yl)methyl]-8-[(3,4-difluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1(Cn2ccc3ccnc(Cl)c32)CC2CCC(C1)N2Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H22ClF2N3O/c23-21-20-15(5-7-26-21)6-8-27(20)13-22(29)10-16-2-3-17(11-22)28(16)12-14-1-4-18(24)19(25)9-14/h1,4-9,16-17,29H,2-3,10-13H2 |
| InChIKey | RKBBDRMJFSYGJL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|