C25H34N2O2 — CID 110216393
3-[(5-tert-butyl-2-methoxyphenyl)methyl]-9-pyridin-3-yl-3-azabicyclo[3.3.1]nonan-9-ol (PubChem CID 110216393) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 3-[(5-tert-butyl-2-methoxyphenyl)methyl]-9-pyridin-3-yl-3-azabicyclo[3.3.1]nonan-9-ol.
| Compound Name | 3-[(5-tert-butyl-2-methoxyphenyl)methyl]-9-pyridin-3-yl-3-azabicyclo[3.3.1]nonan-9-ol |
|---|---|
| PubChem CID | 110216393 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 3-[(5-tert-butyl-2-methoxyphenyl)methyl]-9-pyridin-3-yl-3-azabicyclo[3.3.1]nonan-9-ol |
| SMILES | COc1ccc(C(C)(C)C)cc1CN1CC2CCCC(C1)C2(O)c1cccnc1 |
| InChI | InChI=1S/C25H34N2O2/c1-24(2,3)19-10-11-23(29-4)18(13-19)15-27-16-21-7-5-8-22(17-27)25(21,28)20-9-6-12-26-14-20/h6,9-14,21-22,28H,5,7-8,15-17H2,1-4H3 |
| InChIKey | JOCSVJSQUWGLAR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |