C21H24N6O2 — CID 110219460
8-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]-10-phenyl-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-7-one (PubChem CID 110219460) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 8-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]-10-phenyl-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-7-one.
| Compound Name | 8-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]-10-phenyl-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-7-one |
|---|---|
| PubChem CID | 110219460 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 8-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]-10-phenyl-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-7-one |
| SMILES | CC1CCCCN1C(=O)CN1C(=O)N2CCN=C2c2cnn(-c3ccccc3)c21 |
| InChI | InChI=1S/C21H24N6O2/c1-15-7-5-6-11-24(15)18(28)14-26-20-17(19-22-10-12-25(19)21(26)29)13-23-27(20)16-8-3-2-4-9-16/h2-4,8-9,13,15H,5-7,10-12,14H2,1H3 |
| InChIKey | HAHPRAQRZPZFRM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 74.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |