C22H26N6O2 — CID 92583869
N-[(1R,2S)-2-methylcyclohexyl]-2-(7-oxo-10-phenyl-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-8-yl)acetamide (PubChem CID 92583869) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is N-[(1R,2S)-2-methylcyclohexyl]-2-(7-oxo-10-phenyl-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-8-yl)acetamide.
| Compound Name | N-[(1R,2S)-2-methylcyclohexyl]-2-(7-oxo-10-phenyl-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-8-yl)acetamide |
|---|---|
| PubChem CID | 92583869 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | N-[(1R,2S)-2-methylcyclohexyl]-2-(7-oxo-10-phenyl-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-8-yl)acetamide |
| SMILES | C[C@H]1CCCC[C@H]1NC(=O)CN1C(=O)N2CCN=C2c2cnn(-c3ccccc3)c21 |
| InChI | InChI=1S/C22H26N6O2/c1-15-7-5-6-10-18(15)25-19(29)14-27-21-17(20-23-11-12-26(20)22(27)30)13-24-28(21)16-8-3-2-4-9-16/h2-4,8-9,13,15,18H,5-7,10-12,14H2,1H3,(H,25,29)/t15-,18+/m0/s1 |
| InChIKey | LLTLDLPWDDXYAI-MAUKXSAKSA-N |
| XLogP | 2.57 |
| TPSA | 82.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |