C25H33N5O2 — CID 110219759
cyclohexyl-[3-(2-morpholin-4-yl-5-pyridin-4-ylpyrimidin-4-yl)piperidin-1-yl]methanone (PubChem CID 110219759) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is cyclohexyl-[3-(2-morpholin-4-yl-5-pyridin-4-ylpyrimidin-4-yl)piperidin-1-yl]methanone.
| Compound Name | cyclohexyl-[3-(2-morpholin-4-yl-5-pyridin-4-ylpyrimidin-4-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110219759 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | cyclohexyl-[3-(2-morpholin-4-yl-5-pyridin-4-ylpyrimidin-4-yl)piperidin-1-yl]methanone |
| SMILES | O=C(C1CCCCC1)N1CCCC(c2nc(N3CCOCC3)ncc2-c2ccncc2)C1 |
| InChI | InChI=1S/C25H33N5O2/c31-24(20-5-2-1-3-6-20)30-12-4-7-21(18-30)23-22(19-8-10-26-11-9-19)17-27-25(28-23)29-13-15-32-16-14-29/h8-11,17,20-21H,1-7,12-16,18H2 |
| InChIKey | VPPVKWVPRDVQCO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |