C22H27N5O4 — CID 95799941
ethyl 2-[(3S)-3-(2-morpholin-4-yl-5-pyridin-3-ylpyrimidin-4-yl)piperidin-1-yl]-2-oxoacetate (PubChem CID 95799941) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is ethyl 2-[(3S)-3-(2-morpholin-4-yl-5-pyridin-3-ylpyrimidin-4-yl)piperidin-1-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[(3S)-3-(2-morpholin-4-yl-5-pyridin-3-ylpyrimidin-4-yl)piperidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 95799941 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | ethyl 2-[(3S)-3-(2-morpholin-4-yl-5-pyridin-3-ylpyrimidin-4-yl)piperidin-1-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N1CCC[C@H](c2nc(N3CCOCC3)ncc2-c2cccnc2)C1 |
| InChI | InChI=1S/C22H27N5O4/c1-2-31-21(29)20(28)27-8-4-6-17(15-27)19-18(16-5-3-7-23-13-16)14-24-22(25-19)26-9-11-30-12-10-26/h3,5,7,13-14,17H,2,4,6,8-12,15H2,1H3/t17-/m0/s1 |
| InChIKey | ZCYHXPGRZVZQRG-KRWDZBQOSA-N |
| XLogP | 1.64 |
| TPSA | 97.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|