C18H23N5O3S — CID 110220092
(1,3-dimethylpyrazol-4-yl)-[4-(1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl)piperidin-1-yl]methanone (PubChem CID 110220092) has the molecular formula C18H23N5O3S and a molecular weight of 389.48 g/mol. Its IUPAC name is (1,3-dimethylpyrazol-4-yl)-[4-(1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl)piperidin-1-yl]methanone.
| Compound Name | (1,3-dimethylpyrazol-4-yl)-[4-(1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110220092 |
| Molecular Formula | C18H23N5O3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | (1,3-dimethylpyrazol-4-yl)-[4-(1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl)piperidin-1-yl]methanone |
| SMILES | Cc1nn(C)cc1C(=O)N1CCC(C2Nc3ccccc3S(=O)(=O)N2)CC1 |
| InChI | InChI=1S/C18H23N5O3S/c1-12-14(11-22(2)20-12)18(24)23-9-7-13(8-10-23)17-19-15-5-3-4-6-16(15)27(25,26)21-17/h3-6,11,13,17,19,21H,7-10H2,1-2H3 |
| InChIKey | MJEVPITYDHKNIG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |