C22H25N5O3S — CID 95800188
(1,2-dimethylbenzimidazol-5-yl)-[4-[(3S)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl]piperidin-1-yl]methanone (PubChem CID 95800188) has the molecular formula C22H25N5O3S and a molecular weight of 439.54 g/mol. Its IUPAC name is (1,2-dimethylbenzimidazol-5-yl)-[4-[(3S)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl]piperidin-1-yl]methanone.
| Compound Name | (1,2-dimethylbenzimidazol-5-yl)-[4-[(3S)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95800188 |
| Molecular Formula | C22H25N5O3S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (1,2-dimethylbenzimidazol-5-yl)-[4-[(3S)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl]piperidin-1-yl]methanone |
| SMILES | Cc1nc2cc(C(=O)N3CCC([C@H]4Nc5ccccc5S(=O)(=O)N4)CC3)ccc2n1C |
| InChI | InChI=1S/C22H25N5O3S/c1-14-23-18-13-16(7-8-19(18)26(14)2)22(28)27-11-9-15(10-12-27)21-24-17-5-3-4-6-20(17)31(29,30)25-21/h3-8,13,15,21,24-25H,9-12H2,1-2H3/t21-/m0/s1 |
| InChIKey | FVNHMUSDGRMNIM-NRFANRHFSA-N |
| XLogP | 2.46 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |