C21H20N4O — CID 46981415
(1,2-dimethylbenzimidazol-5-yl)-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone (PubChem CID 46981415) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is (1,2-dimethylbenzimidazol-5-yl)-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone.
| Compound Name | (1,2-dimethylbenzimidazol-5-yl)-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 46981415 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (1,2-dimethylbenzimidazol-5-yl)-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
| SMILES | Cc1nc2cc(C(=O)N3CCc4[nH]c5ccccc5c4C3)ccc2n1C |
| InChI | InChI=1S/C21H20N4O/c1-13-22-19-11-14(7-8-20(19)24(13)2)21(26)25-10-9-18-16(12-25)15-5-3-4-6-17(15)23-18/h3-8,11,23H,9-10,12H2,1-2H3 |
| InChIKey | ZXJNLQZMQKFZCM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|