C26H27N3O2 — CID 110220853
[2-[4-[(3-prop-2-ynoxyphenyl)methyl]piperazin-1-yl]phenyl]-pyridin-2-ylmethanol (PubChem CID 110220853) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is [2-[4-[(3-prop-2-ynoxyphenyl)methyl]piperazin-1-yl]phenyl]-pyridin-2-ylmethanol.
| Compound Name | [2-[4-[(3-prop-2-ynoxyphenyl)methyl]piperazin-1-yl]phenyl]-pyridin-2-ylmethanol |
|---|---|
| PubChem CID | 110220853 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | [2-[4-[(3-prop-2-ynoxyphenyl)methyl]piperazin-1-yl]phenyl]-pyridin-2-ylmethanol |
| SMILES | C#CCOc1cccc(CN2CCN(c3ccccc3C(O)c3ccccn3)CC2)c1 |
| InChI | InChI=1S/C26H27N3O2/c1-2-18-31-22-9-7-8-21(19-22)20-28-14-16-29(17-15-28)25-12-4-3-10-23(25)26(30)24-11-5-6-13-27-24/h1,3-13,19,26,30H,14-18,20H2 |
| InChIKey | IJXHBXPAEDFLTG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|