About [2-[4-[(3,5-difluorophenyl)methyl]piperazin-1-yl]phenyl]-(1,3-thiazol-2-yl)methanol
[2-[4-[(3,5-difluorophenyl)methyl]piperazin-1-yl]phenyl]-(1,3-thiazol-2-yl)methanol (PubChem CID 110220734) has the molecular formula C21H21F2N3OS
and a molecular weight of 401.48 g/mol. Its IUPAC name is [2-[4-[(3,5-difluorophenyl)methyl]piperazin-1-yl]phenyl]-(1,3-thiazol-2-yl)methanol.
Molecular Properties
| Compound Name | [2-[4-[(3,5-difluorophenyl)methyl]piperazin-1-yl]phenyl]-(1,3-thiazol-2-yl)methanol |
| PubChem CID | 110220734 |
| Molecular Formula | C21H21F2N3OS |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | [2-[4-[(3,5-difluorophenyl)methyl]piperazin-1-yl]phenyl]-(1,3-thiazol-2-yl)methanol |
| SMILES | OC(c1nccs1)c1ccccc1N1CCN(Cc2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C21H21F2N3OS/c22-16-11-15(12-17(23)13-16)14-25-6-8-26(9-7-25)19-4-2-1-3-18(19)20(27)21-24-5-10-28-21/h1-5,10-13,20,27H,6-9,14H2 |
| InChIKey | QZQFTDQORQGQAK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[4-[(3,5-difluorophenyl)methyl]piperazin-1-yl]phenyl]-(1,3-thiazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-[(3,5-difluorophenyl)methyl]piperazin-1-yl]phenyl]-(1,3-thiazol-2-yl)methanol?
The IUPAC name of [2-[4-[(3,5-difluorophenyl)methyl]piperazin-1-yl]phenyl]-(1,3-thiazol-2-yl)methanol (CID 110220734) is [2-[4-[(3,5-difluorophenyl)methyl]piperazin-1-yl]phenyl]-(1,3-thiazol-2-yl)methanol.
What is the SMILES notation for [2-[4-[(3,5-difluorophenyl)methyl]piperazin-1-yl]phenyl]-(1,3-thiazol-2-yl)methanol?
The canonical SMILES for [2-[4-[(3,5-difluorophenyl)methyl]piperazin-1-yl]phenyl]-(1,3-thiazol-2-yl)methanol is OC(c1nccs1)c1ccccc1N1CCN(Cc2cc(F)cc(F)c2)CC1.
What is the InChIKey of [2-[4-[(3,5-difluorophenyl)methyl]piperazin-1-yl]phenyl]-(1,3-thiazol-2-yl)methanol?
The InChIKey is QZQFTDQORQGQAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21F2N3OS/c22-16-11-15(12-17(23)13-16)14-25-6-8-26(9-7-25)19-4-2-1-3-18(19)20(27)21-24-5-10-28-21/h1-5,10-13,20,27H,6-9,14H2.
What are the key properties of [2-[4-[(3,5-difluorophenyl)methyl]piperazin-1-yl]phenyl]-(1,3-thiazol-2-yl)methanol?
[2-[4-[(3,5-difluorophenyl)methyl]piperazin-1-yl]phenyl]-(1,3-thiazol-2-yl)methanol has a molecular weight of 401.48 g/mol, XLogP of 3.83, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-[(3,5-difluorophenyl)methyl]piperazin-1-yl]phenyl]-(1,3-thiazol-2-yl)methanol is sourced from PubChem (CID 110220734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).