C16H24O4 — CID 11022304
methyl (2S)-2-[(1aR,2R,4aS,7R,8aS)-2-hydroxy-1a,4a-dimethyl-5,6,7,8-tetrahydro-2H-naphtho[1,8a-b]oxiren-7-yl]propanoate (PubChem CID 11022304) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is methyl (2S)-2-[(1aR,2R,4aS,7R,8aS)-2-hydroxy-1a,4a-dimethyl-5,6,7,8-tetrahydro-2H-naphtho[1,8a-b]oxiren-7-yl]propanoate.
| Compound Name | methyl (2S)-2-[(1aR,2R,4aS,7R,8aS)-2-hydroxy-1a,4a-dimethyl-5,6,7,8-tetrahydro-2H-naphtho[1,8a-b]oxiren-7-yl]propanoate |
|---|---|
| PubChem CID | 11022304 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | methyl (2S)-2-[(1aR,2R,4aS,7R,8aS)-2-hydroxy-1a,4a-dimethyl-5,6,7,8-tetrahydro-2H-naphtho[1,8a-b]oxiren-7-yl]propanoate |
| SMILES | COC(=O)[C@@H](C)[C@@H]1CC[C@@]2(C)C=C[C@@H](O)[C@@]3(C)O[C@@]23C1 |
| InChI | InChI=1S/C16H24O4/c1-10(13(18)19-4)11-5-7-14(2)8-6-12(17)15(3)16(14,9-11)20-15/h6,8,10-12,17H,5,7,9H2,1-4H3/t10-,11+,12+,14-,15+,16-/m0/s1 |
| InChIKey | PTOVBRWTPHIEKM-YMZCTANMSA-N |
| XLogP | 2.06 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|