C20H22N6O — CID 110223102
[(10aR)-2,10a-dimethyl-5,6,6a,8,9,10-hexahydropyrido[2,3-h]quinazolin-7-yl]-pyrazolo[1,5-a]pyrimidin-3-ylmethanone (PubChem CID 110223102) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is [(10aR)-2,10a-dimethyl-5,6,6a,8,9,10-hexahydropyrido[2,3-h]quinazolin-7-yl]-pyrazolo[1,5-a]pyrimidin-3-ylmethanone.
| Compound Name | [(10aR)-2,10a-dimethyl-5,6,6a,8,9,10-hexahydropyrido[2,3-h]quinazolin-7-yl]-pyrazolo[1,5-a]pyrimidin-3-ylmethanone |
|---|---|
| PubChem CID | 110223102 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | [(10aR)-2,10a-dimethyl-5,6,6a,8,9,10-hexahydropyrido[2,3-h]quinazolin-7-yl]-pyrazolo[1,5-a]pyrimidin-3-ylmethanone |
| SMILES | Cc1ncc2c(n1)[C@]1(C)CCCN(C(=O)c3cnn4cccnc34)C1CC2 |
| InChI | InChI=1S/C20H22N6O/c1-13-22-11-14-5-6-16-20(2,17(14)24-13)7-3-9-25(16)19(27)15-12-23-26-10-4-8-21-18(15)26/h4,8,10-12,16H,3,5-7,9H2,1-2H3/t16?,20-/m1/s1 |
| InChIKey | IFBBEHNVRKINAE-OTOKDRCRSA-N |
| XLogP | 2.34 |
| TPSA | 76.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |