C25H28N4O4 — CID 110223110
3-[(10aR)-2,10a-dimethyl-5,6,6a,8,9,10-hexahydropyrido[2,3-h]quinazoline-7-carbonyl]-5,8-dimethoxy-1H-quinolin-4-one (PubChem CID 110223110) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 3-[(10aR)-2,10a-dimethyl-5,6,6a,8,9,10-hexahydropyrido[2,3-h]quinazoline-7-carbonyl]-5,8-dimethoxy-1H-quinolin-4-one.
| Compound Name | 3-[(10aR)-2,10a-dimethyl-5,6,6a,8,9,10-hexahydropyrido[2,3-h]quinazoline-7-carbonyl]-5,8-dimethoxy-1H-quinolin-4-one |
|---|---|
| PubChem CID | 110223110 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 3-[(10aR)-2,10a-dimethyl-5,6,6a,8,9,10-hexahydropyrido[2,3-h]quinazoline-7-carbonyl]-5,8-dimethoxy-1H-quinolin-4-one |
| SMILES | COc1ccc(OC)c2c(=O)c(C(=O)N3CCC[C@@]4(C)c5nc(C)ncc5CCC34)c[nH]c12 |
| InChI | InChI=1S/C25H28N4O4/c1-14-26-12-15-6-9-19-25(2,23(15)28-14)10-5-11-29(19)24(31)16-13-27-21-18(33-4)8-7-17(32-3)20(21)22(16)30/h7-8,12-13,19H,5-6,9-11H2,1-4H3,(H,27,30)/t19?,25-/m1/s1 |
| InChIKey | ADSGZBRQFBBPSH-OPEAARRCSA-N |
| XLogP | 3.15 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |