C20H24N4O3S — CID 110223656
2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[1-[2-(1,3-thiazol-2-yl)ethynyl]cyclohexyl]acetamide (PubChem CID 110223656) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[1-[2-(1,3-thiazol-2-yl)ethynyl]cyclohexyl]acetamide.
| Compound Name | 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[1-[2-(1,3-thiazol-2-yl)ethynyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 110223656 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[1-[2-(1,3-thiazol-2-yl)ethynyl]cyclohexyl]acetamide |
| SMILES | CC1(C2CC2)NC(=O)N(CC(=O)NC2(C#Cc3nccs3)CCCCC2)C1=O |
| InChI | InChI=1S/C20H24N4O3S/c1-19(14-5-6-14)17(26)24(18(27)23-19)13-15(25)22-20(8-3-2-4-9-20)10-7-16-21-11-12-28-16/h11-12,14H,2-6,8-9,13H2,1H3,(H,22,25)(H,23,27) |
| InChIKey | PCMINYDXIODQID-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|