C13H15F3N2O2 — CID 11022536
1-hexyl-2-hydroxy-6-oxo-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 11022536) has the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is 1-hexyl-2-hydroxy-6-oxo-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 1-hexyl-2-hydroxy-6-oxo-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 11022536 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-hexyl-2-hydroxy-6-oxo-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | CCCCCCn1c(O)c(C#N)c(C(F)(F)F)cc1=O |
| InChI | InChI=1S/C13H15F3N2O2/c1-2-3-4-5-6-18-11(19)7-10(13(14,15)16)9(8-17)12(18)20/h7,20H,2-6H2,1H3 |
| InChIKey | OVWYHWXLNFCWEG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|