C10H9F3N2O2 — CID 54226750
2-hydroxy-6-oxo-1-propyl-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 54226750) has the molecular formula C10H9F3N2O2 and a molecular weight of 246.19 g/mol. Its IUPAC name is 2-hydroxy-6-oxo-1-propyl-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-hydroxy-6-oxo-1-propyl-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 54226750 |
| Molecular Formula | C10H9F3N2O2 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2-hydroxy-6-oxo-1-propyl-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | CCCn1c(O)c(C#N)c(C(F)(F)F)cc1=O |
| InChI | InChI=1S/C10H9F3N2O2/c1-2-3-15-8(16)4-7(10(11,12)13)6(5-14)9(15)17/h4,17H,2-3H2,1H3 |
| InChIKey | ARQUPKCRPLWDJN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |