C21H32N4O2 — CID 110225461
3,3-dimethyl-1-[5-methyl-3-(oxolan-2-ylmethylamino)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-yl]butan-1-one (PubChem CID 110225461) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 3,3-dimethyl-1-[5-methyl-3-(oxolan-2-ylmethylamino)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-yl]butan-1-one.
| Compound Name | 3,3-dimethyl-1-[5-methyl-3-(oxolan-2-ylmethylamino)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-yl]butan-1-one |
|---|---|
| PubChem CID | 110225461 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 3,3-dimethyl-1-[5-methyl-3-(oxolan-2-ylmethylamino)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-yl]butan-1-one |
| SMILES | Cc1nc2c(c(NCC3CCCO3)n1)C1CCC(C2)N1C(=O)CC(C)(C)C |
| InChI | InChI=1S/C21H32N4O2/c1-13-23-16-10-14-7-8-17(25(14)18(26)11-21(2,3)4)19(16)20(24-13)22-12-15-6-5-9-27-15/h14-15,17H,5-12H2,1-4H3,(H,22,23,24) |
| InChIKey | LWHTZSQOJQISBM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |