C24H32N4O3 — CID 98077062
[2-methoxy-5-[[(1S,9S)-5-methyl-3-[[(2R)-oxolan-2-yl]methylamino]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-yl]methyl]phenyl]methanol (PubChem CID 98077062) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is [2-methoxy-5-[[(1S,9S)-5-methyl-3-[[(2R)-oxolan-2-yl]methylamino]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-yl]methyl]phenyl]methanol.
| Compound Name | [2-methoxy-5-[[(1S,9S)-5-methyl-3-[[(2R)-oxolan-2-yl]methylamino]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-yl]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 98077062 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | [2-methoxy-5-[[(1S,9S)-5-methyl-3-[[(2R)-oxolan-2-yl]methylamino]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-yl]methyl]phenyl]methanol |
| SMILES | COc1ccc(CN2[C@H]3CC[C@H]2c2c(nc(C)nc2NC[C@H]2CCCO2)C3)cc1CO |
| InChI | InChI=1S/C24H32N4O3/c1-15-26-20-11-18-6-7-21(23(20)24(27-15)25-12-19-4-3-9-31-19)28(18)13-16-5-8-22(30-2)17(10-16)14-29/h5,8,10,18-19,21,29H,3-4,6-7,9,11-14H2,1-2H3,(H,25,26,27)/t18-,19+,21-/m0/s1 |
| InChIKey | JFZBOIGZVMQSDI-ZVDOUQERSA-N |
| XLogP | 3.14 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |