C22H25N3O3 — CID 117090820
6,7-dimethoxy-2-(3-methylphenyl)-N-(oxolan-2-ylmethyl)quinazolin-4-amine (PubChem CID 117090820) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 6,7-dimethoxy-2-(3-methylphenyl)-N-(oxolan-2-ylmethyl)quinazolin-4-amine.
| Compound Name | 6,7-dimethoxy-2-(3-methylphenyl)-N-(oxolan-2-ylmethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 117090820 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 6,7-dimethoxy-2-(3-methylphenyl)-N-(oxolan-2-ylmethyl)quinazolin-4-amine |
| SMILES | COc1cc2nc(-c3cccc(C)c3)nc(NCC3CCCO3)c2cc1OC |
| InChI | InChI=1S/C22H25N3O3/c1-14-6-4-7-15(10-14)21-24-18-12-20(27-3)19(26-2)11-17(18)22(25-21)23-13-16-8-5-9-28-16/h4,6-7,10-12,16H,5,8-9,13H2,1-3H3,(H,23,24,25) |
| InChIKey | WTNOYKAODMCXCL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |