C22H25N3O4 — CID 44968192
N-(oxolan-2-ylmethyl)-6-(3,4,5-trimethoxyphenyl)quinazolin-4-amine (PubChem CID 44968192) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-6-(3,4,5-trimethoxyphenyl)quinazolin-4-amine.
| Compound Name | N-(oxolan-2-ylmethyl)-6-(3,4,5-trimethoxyphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 44968192 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-6-(3,4,5-trimethoxyphenyl)quinazolin-4-amine |
| SMILES | COc1cc(-c2ccc3ncnc(NCC4CCCO4)c3c2)cc(OC)c1OC |
| InChI | InChI=1S/C22H25N3O4/c1-26-19-10-15(11-20(27-2)21(19)28-3)14-6-7-18-17(9-14)22(25-13-24-18)23-12-16-5-4-8-29-16/h6-7,9-11,13,16H,4-5,8,12H2,1-3H3,(H,23,24,25) |
| InChIKey | PNJSKVUDIJBQSE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |