C12H13FN4O — CID 59987540
6-fluoro-N-(oxolan-2-ylmethyl)pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 59987540) has the molecular formula C12H13FN4O and a molecular weight of 248.26 g/mol. Its IUPAC name is 6-fluoro-N-(oxolan-2-ylmethyl)pyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-fluoro-N-(oxolan-2-ylmethyl)pyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 59987540 |
| Molecular Formula | C12H13FN4O |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 6-fluoro-N-(oxolan-2-ylmethyl)pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | Fc1cc2c(NCC3CCCO3)ncnc2cn1 |
| InChI | InChI=1S/C12H13FN4O/c13-11-4-9-10(6-14-11)16-7-17-12(9)15-5-8-2-1-3-18-8/h4,6-8H,1-3,5H2,(H,15,16,17) |
| InChIKey | QXCUIHUHNIYMHN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|