C18H17N3O4 — CID 46916183
5-[4-(oxolan-2-ylmethylamino)quinazolin-6-yl]furan-2-carboxylic acid (PubChem CID 46916183) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 5-[4-(oxolan-2-ylmethylamino)quinazolin-6-yl]furan-2-carboxylic acid.
| Compound Name | 5-[4-(oxolan-2-ylmethylamino)quinazolin-6-yl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 46916183 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 5-[4-(oxolan-2-ylmethylamino)quinazolin-6-yl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2ccc3ncnc(NCC4CCCO4)c3c2)o1 |
| InChI | InChI=1S/C18H17N3O4/c22-18(23)16-6-5-15(25-16)11-3-4-14-13(8-11)17(21-10-20-14)19-9-12-2-1-7-24-12/h3-6,8,10,12H,1-2,7,9H2,(H,22,23)(H,19,20,21) |
| InChIKey | UNRGMDFGOBNOBE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |