C15H19N3O3S — CID 3243470
6,7-dimethoxy-4-(oxolan-2-ylmethylamino)-1H-quinazoline-2-thione (PubChem CID 3243470) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 6,7-dimethoxy-4-(oxolan-2-ylmethylamino)-1H-quinazoline-2-thione.
| Compound Name | 6,7-dimethoxy-4-(oxolan-2-ylmethylamino)-1H-quinazoline-2-thione |
|---|---|
| PubChem CID | 3243470 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 6,7-dimethoxy-4-(oxolan-2-ylmethylamino)-1H-quinazoline-2-thione |
| SMILES | COc1cc2[nH]c(=S)nc(NCC3CCCO3)c2cc1OC |
| InChI | InChI=1S/C15H19N3O3S/c1-19-12-6-10-11(7-13(12)20-2)17-15(22)18-14(10)16-8-9-4-3-5-21-9/h6-7,9H,3-5,8H2,1-2H3,(H2,16,17,18,22) |
| InChIKey | CTYSCOMGJSFQHS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|