C21H26N4O2S — CID 44522095
4-[3-(N-ethylanilino)propylamino]-6,7-dimethoxy-1H-quinazoline-2-thione (PubChem CID 44522095) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is 4-[3-(N-ethylanilino)propylamino]-6,7-dimethoxy-1H-quinazoline-2-thione.
| Compound Name | 4-[3-(N-ethylanilino)propylamino]-6,7-dimethoxy-1H-quinazoline-2-thione |
|---|---|
| PubChem CID | 44522095 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 4-[3-(N-ethylanilino)propylamino]-6,7-dimethoxy-1H-quinazoline-2-thione |
| SMILES | CCN(CCCNc1nc(=S)[nH]c2cc(OC)c(OC)cc12)c1ccccc1 |
| InChI | InChI=1S/C21H26N4O2S/c1-4-25(15-9-6-5-7-10-15)12-8-11-22-20-16-13-18(26-2)19(27-3)14-17(16)23-21(28)24-20/h5-7,9-10,13-14H,4,8,11-12H2,1-3H3,(H2,22,23,24,28) |
| InChIKey | LCLBTVVCAVJDCP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 62.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|