C24H36N4O3 — CID 111390471
1-ethyl-3-[3-(N-ethylanilino)propyl]-2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]guanidine (PubChem CID 111390471) has the molecular formula C24H36N4O3 and a molecular weight of 428.58 g/mol. Its IUPAC name is 1-ethyl-3-[3-(N-ethylanilino)propyl]-2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(N-ethylanilino)propyl]-2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111390471 |
| Molecular Formula | C24H36N4O3 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | 1-ethyl-3-[3-(N-ethylanilino)propyl]-2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OCCO)c(OC)c1)NCCCN(CC)c1ccccc1 |
| InChI | InChI=1S/C24H36N4O3/c1-4-25-24(26-14-9-15-28(5-2)21-10-7-6-8-11-21)27-19-20-12-13-22(31-17-16-29)23(18-20)30-3/h6-8,10-13,18,29H,4-5,9,14-17,19H2,1-3H3,(H2,25,26,27) |
| InChIKey | VRKMVDXPFDQADE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|