C23H34IN5O — CID 111390376
3-[[[ethylamino-[3-(N-ethylanilino)propylamino]methylidene]amino]methyl]-N-methylbenzamide;hydroiodide (PubChem CID 111390376) has the molecular formula C23H34IN5O and a molecular weight of 523.46 g/mol. Its IUPAC name is 3-[[[ethylamino-[3-(N-ethylanilino)propylamino]methylidene]amino]methyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 3-[[[ethylamino-[3-(N-ethylanilino)propylamino]methylidene]amino]methyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111390376 |
| Molecular Formula | C23H34IN5O |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | 3-[[[ethylamino-[3-(N-ethylanilino)propylamino]methylidene]amino]methyl]-N-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC)c1)NCCCN(CC)c1ccccc1.I |
| InChI | InChI=1S/C23H33N5O.HI/c1-4-25-23(27-18-19-11-9-12-20(17-19)22(29)24-3)26-15-10-16-28(5-2)21-13-7-6-8-14-21;/h6-9,11-14,17H,4-5,10,15-16,18H2,1-3H3,(H,24,29)(H2,25,26,27);1H |
| InChIKey | VNADFBKUQGCFTG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|