C18H27N5O3S — CID 110227267
5-(1-methylsulfonylpiperidin-3-yl)-11-propan-2-yl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 110227267) has the molecular formula C18H27N5O3S and a molecular weight of 393.51 g/mol. Its IUPAC name is 5-(1-methylsulfonylpiperidin-3-yl)-11-propan-2-yl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 5-(1-methylsulfonylpiperidin-3-yl)-11-propan-2-yl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 110227267 |
| Molecular Formula | C18H27N5O3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 5-(1-methylsulfonylpiperidin-3-yl)-11-propan-2-yl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | CC(C)N1CCc2nc3cc(C4CCCN(S(C)(=O)=O)C4)[nH]n3c(=O)c2C1 |
| InChI | InChI=1S/C18H27N5O3S/c1-12(2)21-8-6-15-14(11-21)18(24)23-17(19-15)9-16(20-23)13-5-4-7-22(10-13)27(3,25)26/h9,12-13,20H,4-8,10-11H2,1-3H3 |
| InChIKey | SIPJZOSIHFZZAQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |