C19H29N5O3S — CID 92587689
5-[(3S)-1-ethylsulfonylpiperidin-3-yl]-11-propan-2-yl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 92587689) has the molecular formula C19H29N5O3S and a molecular weight of 407.54 g/mol. Its IUPAC name is 5-[(3S)-1-ethylsulfonylpiperidin-3-yl]-11-propan-2-yl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 5-[(3S)-1-ethylsulfonylpiperidin-3-yl]-11-propan-2-yl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 92587689 |
| Molecular Formula | C19H29N5O3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 5-[(3S)-1-ethylsulfonylpiperidin-3-yl]-11-propan-2-yl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | CCS(=O)(=O)N1CCC[C@H](c2cc3nc4c(c(=O)n3[nH]2)CN(C(C)C)CC4)C1 |
| InChI | InChI=1S/C19H29N5O3S/c1-4-28(26,27)23-8-5-6-14(11-23)17-10-18-20-16-7-9-22(13(2)3)12-15(16)19(25)24(18)21-17/h10,13-14,21H,4-9,11-12H2,1-3H3/t14-/m0/s1 |
| InChIKey | VUGLOYHRSXKAQR-AWEZNQCLSA-N |
| XLogP | 1.32 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |