C23H30N6O3 — CID 92589026
5-[1-(5-ethyl-1,2-oxazole-3-carbonyl)piperidin-4-yl]-11-propan-2-yl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 92589026) has the molecular formula C23H30N6O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is 5-[1-(5-ethyl-1,2-oxazole-3-carbonyl)piperidin-4-yl]-11-propan-2-yl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 5-[1-(5-ethyl-1,2-oxazole-3-carbonyl)piperidin-4-yl]-11-propan-2-yl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 92589026 |
| Molecular Formula | C23H30N6O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 5-[1-(5-ethyl-1,2-oxazole-3-carbonyl)piperidin-4-yl]-11-propan-2-yl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | CCc1cc(C(=O)N2CCC(c3cc4nc5c(c(=O)n4[nH]3)CN(C(C)C)CC5)CC2)no1 |
| InChI | InChI=1S/C23H30N6O3/c1-4-16-11-20(26-32-16)23(31)27-8-5-15(6-9-27)19-12-21-24-18-7-10-28(14(2)3)13-17(18)22(30)29(21)25-19/h11-12,14-15,25H,4-10,13H2,1-3H3 |
| InChIKey | WLSPUPVZMRAPKB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |