C21H29N5O4S — CID 110227316
11-(oxan-4-yl)-5-(1-prop-2-enylsulfonylpyrrolidin-2-yl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 110227316) has the molecular formula C21H29N5O4S and a molecular weight of 447.56 g/mol. Its IUPAC name is 11-(oxan-4-yl)-5-(1-prop-2-enylsulfonylpyrrolidin-2-yl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 11-(oxan-4-yl)-5-(1-prop-2-enylsulfonylpyrrolidin-2-yl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 110227316 |
| Molecular Formula | C21H29N5O4S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 11-(oxan-4-yl)-5-(1-prop-2-enylsulfonylpyrrolidin-2-yl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | C=CCS(=O)(=O)N1CCCC1c1cc2nc3c(c(=O)n2[nH]1)CN(C1CCOCC1)CC3 |
| InChI | InChI=1S/C21H29N5O4S/c1-2-12-31(28,29)25-8-3-4-19(25)18-13-20-22-17-5-9-24(15-6-10-30-11-7-15)14-16(17)21(27)26(20)23-18/h2,13,15,19,23H,1,3-12,14H2 |
| InChIKey | QQRBBXATEIKGSJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|