C24H33N5O3 — CID 110227334
5-[1-(cyclopentanecarbonyl)pyrrolidin-2-yl]-12-(2,2-dimethylpropanoyl)-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 110227334) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 5-[1-(cyclopentanecarbonyl)pyrrolidin-2-yl]-12-(2,2-dimethylpropanoyl)-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 5-[1-(cyclopentanecarbonyl)pyrrolidin-2-yl]-12-(2,2-dimethylpropanoyl)-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 110227334 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 5-[1-(cyclopentanecarbonyl)pyrrolidin-2-yl]-12-(2,2-dimethylpropanoyl)-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | CC(C)(C)C(=O)N1CCc2c(nc3cc(C4CCCN4C(=O)C4CCCC4)[nH]n3c2=O)C1 |
| InChI | InChI=1S/C24H33N5O3/c1-24(2,3)23(32)27-12-10-16-18(14-27)25-20-13-17(26-29(20)22(16)31)19-9-6-11-28(19)21(30)15-7-4-5-8-15/h13,15,19,26H,4-12,14H2,1-3H3 |
| InChIKey | HULOCHVPUIKQGR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |