C24H30N6O2 — CID 98080220
12-(2,2-dimethylpropanoyl)-5-[(2S)-1-(pyridin-2-ylmethyl)pyrrolidin-2-yl]-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 98080220) has the molecular formula C24H30N6O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 12-(2,2-dimethylpropanoyl)-5-[(2S)-1-(pyridin-2-ylmethyl)pyrrolidin-2-yl]-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 12-(2,2-dimethylpropanoyl)-5-[(2S)-1-(pyridin-2-ylmethyl)pyrrolidin-2-yl]-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 98080220 |
| Molecular Formula | C24H30N6O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 12-(2,2-dimethylpropanoyl)-5-[(2S)-1-(pyridin-2-ylmethyl)pyrrolidin-2-yl]-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | CC(C)(C)C(=O)N1CCc2c(nc3cc([C@@H]4CCCN4Cc4ccccn4)[nH]n3c2=O)C1 |
| InChI | InChI=1S/C24H30N6O2/c1-24(2,3)23(32)29-12-9-17-19(15-29)26-21-13-18(27-30(21)22(17)31)20-8-6-11-28(20)14-16-7-4-5-10-25-16/h4-5,7,10,13,20,27H,6,8-9,11-12,14-15H2,1-3H3/t20-/m0/s1 |
| InChIKey | LWZYYJNHSCXQTC-FQEVSTJZSA-N |
| XLogP | 2.69 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |