C24H29N5O3 — CID 110227179
5-[1-[(2-hydroxyphenyl)methyl]piperidin-2-yl]-12-propanoyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 110227179) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is 5-[1-[(2-hydroxyphenyl)methyl]piperidin-2-yl]-12-propanoyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 5-[1-[(2-hydroxyphenyl)methyl]piperidin-2-yl]-12-propanoyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 110227179 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 5-[1-[(2-hydroxyphenyl)methyl]piperidin-2-yl]-12-propanoyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | CCC(=O)N1CCc2c(nc3cc(C4CCCCN4Cc4ccccc4O)[nH]n3c2=O)C1 |
| InChI | InChI=1S/C24H29N5O3/c1-2-23(31)28-12-10-17-19(15-28)25-22-13-18(26-29(22)24(17)32)20-8-5-6-11-27(20)14-16-7-3-4-9-21(16)30/h3-4,7,9,13,20,26,30H,2,5-6,8,10-12,14-15H2,1H3 |
| InChIKey | PIILKHHKKCNKEF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|