C22H27N5O2S — CID 110227178
12-propanoyl-5-[1-(thiophen-2-ylmethyl)piperidin-2-yl]-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 110227178) has the molecular formula C22H27N5O2S and a molecular weight of 425.56 g/mol. Its IUPAC name is 12-propanoyl-5-[1-(thiophen-2-ylmethyl)piperidin-2-yl]-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 12-propanoyl-5-[1-(thiophen-2-ylmethyl)piperidin-2-yl]-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 110227178 |
| Molecular Formula | C22H27N5O2S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 12-propanoyl-5-[1-(thiophen-2-ylmethyl)piperidin-2-yl]-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | CCC(=O)N1CCc2c(nc3cc(C4CCCCN4Cc4cccs4)[nH]n3c2=O)C1 |
| InChI | InChI=1S/C22H27N5O2S/c1-2-21(28)26-10-8-16-18(14-26)23-20-12-17(24-27(20)22(16)29)19-7-3-4-9-25(19)13-15-6-5-11-30-15/h5-6,11-12,19,24H,2-4,7-10,13-14H2,1H3 |
| InChIKey | NCPVKOMQBQEPAT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 73.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |