C27H30FN3O — CID 110229251
N-[[1-[(4-fluorophenyl)methyl]piperidin-3-yl]-pyridin-2-ylmethyl]-3-phenylpropanamide (PubChem CID 110229251) has the molecular formula C27H30FN3O and a molecular weight of 431.56 g/mol. Its IUPAC name is N-[[1-[(4-fluorophenyl)methyl]piperidin-3-yl]-pyridin-2-ylmethyl]-3-phenylpropanamide.
| Compound Name | N-[[1-[(4-fluorophenyl)methyl]piperidin-3-yl]-pyridin-2-ylmethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 110229251 |
| Molecular Formula | C27H30FN3O |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | N-[[1-[(4-fluorophenyl)methyl]piperidin-3-yl]-pyridin-2-ylmethyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)NC(c1ccccn1)C1CCCN(Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C27H30FN3O/c28-24-14-11-22(12-15-24)19-31-18-6-9-23(20-31)27(25-10-4-5-17-29-25)30-26(32)16-13-21-7-2-1-3-8-21/h1-5,7-8,10-12,14-15,17,23,27H,6,9,13,16,18-20H2,(H,30,32) |
| InChIKey | SSJNHGFHPCFYQM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |