C26H28FN3O — CID 92574484
N-[(S)-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-pyridin-2-ylmethyl]-2-phenylacetamide (PubChem CID 92574484) has the molecular formula C26H28FN3O and a molecular weight of 417.53 g/mol. Its IUPAC name is N-[(S)-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-pyridin-2-ylmethyl]-2-phenylacetamide.
| Compound Name | N-[(S)-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-pyridin-2-ylmethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 92574484 |
| Molecular Formula | C26H28FN3O |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | N-[(S)-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-pyridin-2-ylmethyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)N[C@H](c1ccccn1)C1CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C26H28FN3O/c27-23-11-9-21(10-12-23)19-30-16-13-22(14-17-30)26(24-8-4-5-15-28-24)29-25(31)18-20-6-2-1-3-7-20/h1-12,15,22,26H,13-14,16-19H2,(H,29,31)/t26-/m0/s1 |
| InChIKey | YGSPJKBUGCSNDZ-SANMLTNESA-N |
| XLogP | 4.53 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |