C25H28N4O — CID 92574491
2-phenyl-N-[(S)-pyridin-2-yl-[1-(pyridin-4-ylmethyl)piperidin-4-yl]methyl]acetamide (PubChem CID 92574491) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is 2-phenyl-N-[(S)-pyridin-2-yl-[1-(pyridin-4-ylmethyl)piperidin-4-yl]methyl]acetamide.
| Compound Name | 2-phenyl-N-[(S)-pyridin-2-yl-[1-(pyridin-4-ylmethyl)piperidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 92574491 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 2-phenyl-N-[(S)-pyridin-2-yl-[1-(pyridin-4-ylmethyl)piperidin-4-yl]methyl]acetamide |
| SMILES | O=C(Cc1ccccc1)N[C@H](c1ccccn1)C1CCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C25H28N4O/c30-24(18-20-6-2-1-3-7-20)28-25(23-8-4-5-13-27-23)22-11-16-29(17-12-22)19-21-9-14-26-15-10-21/h1-10,13-15,22,25H,11-12,16-19H2,(H,28,30)/t25-/m0/s1 |
| InChIKey | VHUKIOAFRUQMCY-VWLOTQADSA-N |
| XLogP | 3.79 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |